87-69-4 - Names and IdentifiersNameL(+)-Tartaric acidSynonymsFEMA 3044L-Tartaric AcidL+tartaric
Posta elettronica:services@moutainchem.com
| Nome | L(+)-Tartaric acid |
| Sinonimi | FEMA 3044 L-Tartaric Acid L+tartaric acid L(+)tartaric acid ACIDUM TARTARICUM L(+)-Tartaric acid L(-)-tartaric acid L(+)-Tartaric Acid L-(+)-Tartaric acid DEXTROTARTARIC ACID Natural tartaric acid DIHYDROXYSUCCINIC ACID L-Tartaric acid anhydrous (2R,3R)-(+)-TARTARIC ACID (2S,3S)-(-)-Tartaric acid L(+)-Tartaric Acid (FCCIV) L(+)-Tartaric Acid (BP2000) L(+)-Dihydroxysuccinic acid L(+)tartaric acid sigmaultra 2,3-DIHYDROXYDUTANEDIOIC ACID 2,3-DIHYDROXYBUTANEDIOIC ACID 2,2-dihydroxybutanedioic acid (2R,3R)-2,3-dihydroxybutanedioate (2R,3S)-2,3-dihydroxybutanedioate (2R,3R)-2,3-DIHYDROXYSUCCINIC ACID L(+)-2,3-dihydrooxy butanedioic acid L-1,2-Dihydroxyethan-1,2-dicarbonsaeure |
| CAS | 87-69-4 |
| EINECS | 201-766-0 |
| InChI | InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| Formula molecolare | C4H6O6 |
| massa molare | 150.09 |
| Densità | 1.76 |
| Punto di fusione | 170-172°C(lit.) |
| punto Boling | 191.59°C (rough estimate) |
| Specific Rotation(α) | 12 º (c=20, H2O) |
| Punto Flash | 210 °C |
| JECFA Number | 621 |
| Solubilità in acqua | 1390 g/L (20 ºC) |
| Solubilità | Soluble in water, methanol, propanol, glycerin and ethanol, insoluble in chloroform. |
| Pressione del vapore | <5 Pa (20 °C) |
| Vapor Density | 5.18 (vs air) |
| Aspetto | Cristallo bianco |
| Colore | White or colorless |
| Merck | 14,9070 |
| BRN | 1725147 |
| pKa | 2.98, 4.34(at 25℃) |
| PH | 3.18(1 mM solution);2.55(10 mM solution);2.01(100 mM solution); |
| Condizioni di conservazione | Store at +5°C to +30°C. |
| Stabilità | Stable. Incompatible with oxidizing agents, bases, reducing agents. Combustible. |
| Sensibile | Facile assorbimento dell'umidità |
| Indice di rifrattività | 12.5 ° (C=5, H2O) |
| MDL | MFCD00064207 |
| Proprietà fisiche e chimiche | Density 1.76 melting point 168-172°C flash point 210°C Specific Rotation 12 ° (c = 20, H2O) water-soluble 1390g/L (20°C) |
| Utilizzo | L( )-tartaric acid is widely used as a acidulant for beverages and other foods, for wine, soft drinks, sweets, bread, and certain gum-like sweets. Mainly used as acidulants, resolving agents and pharmaceutical raw materials |
| Simboli di pericolo | Xi - Irritante |
| Codici di rischio | R36/37/38 - Irritante per gli occhi, il sistema respiratorio e la pelle. R41 - Risk of serious damage to eyes |
| Descrizione della sicurezza | S26 In caso di contatto con gli occhi, risciacquare immediatamente con abbastanza acqua e richiedere consulenza medica. S36 - Indossare abbigliamento protettivo adeguato. S37/39 - Indossare guanti adatti e protezione degli occhi/del viso S36/37/39 - Indossare indumenti protettivi adatti, guanti e protezione occhi/viso. |
| WGK Germania | 3 |
| RTECS | WW7875000 |
| TSCA | Sì |
| Codice HS | 29181200 |
| Nota di pericolo | Irritante |
| Raw Materials | Hydrogen peroxide |
Disclaimer: Il contenuto di cui sopra è per riferimento e comunicazione solo tra addetti ai lavori del settore e non garantisce la sua accuratezza o completezza. Secondo le leggi e i regolamenti pertinenti e i regolamenti di questo sito web, le unità o le persone fisiche che acquistano articoli correlati devono ottenere qualifiche e condizioni di qualificazione valide.
Telefono aziendale
+86-21-6420 0566
Orario di lavoro
Da lunedì a venerdì
Telefono cellulare:
13816217984
Posta elettronica:
info@qinsun-lab.com
